About (2S,5S)-1,2-dimethyl-5-phenylpiperazine
(2S,5S)-1,2-dimethyl-5-phenylpiperazine (PubChem CID 96624962) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is (2S,5S)-1,2-dimethyl-5-phenylpiperazine.
Molecular Properties
| Compound Name | (2S,5S)-1,2-dimethyl-5-phenylpiperazine |
| PubChem CID | 96624962 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (2S,5S)-1,2-dimethyl-5-phenylpiperazine |
| SMILES | C[C@H]1CN[C@@H](c2ccccc2)CN1C |
| InChI | InChI=1S/C12H18N2/c1-10-8-13-12(9-14(10)2)11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | LIAMLQFQGPKCFQ-CMPLNLGQSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5S)-1,2-dimethyl-5-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1,2-dimethyl-5-phenylpiperazine?
The IUPAC name of (2S,5S)-1,2-dimethyl-5-phenylpiperazine (CID 96624962) is (2S,5S)-1,2-dimethyl-5-phenylpiperazine.
What is the SMILES notation for (2S,5S)-1,2-dimethyl-5-phenylpiperazine?
The canonical SMILES for (2S,5S)-1,2-dimethyl-5-phenylpiperazine is C[C@H]1CN[C@@H](c2ccccc2)CN1C.
What is the InChIKey of (2S,5S)-1,2-dimethyl-5-phenylpiperazine?
The InChIKey is LIAMLQFQGPKCFQ-CMPLNLGQSA-N. The full InChI is InChI=1S/C12H18N2/c1-10-8-13-12(9-14(10)2)11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t10-,12+/m0/s1.
What are the key properties of (2S,5S)-1,2-dimethyl-5-phenylpiperazine?
(2S,5S)-1,2-dimethyl-5-phenylpiperazine has a molecular weight of 190.29 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1,2-dimethyl-5-phenylpiperazine is sourced from PubChem (CID 96624962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).