C13H19F2N — CID 145285471
4,4-difluoro-2-phenylpiperidine;ethane (PubChem CID 145285471) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 4,4-difluoro-2-phenylpiperidine;ethane.
| Compound Name | 4,4-difluoro-2-phenylpiperidine;ethane |
|---|---|
| PubChem CID | 145285471 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4,4-difluoro-2-phenylpiperidine;ethane |
| SMILES | CC.FC1(F)CCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C11H13F2N.C2H6/c12-11(13)6-7-14-10(8-11)9-4-2-1-3-5-9;1-2/h1-5,10,14H,6-8H2;1-2H3 |
| InChIKey | GICGDKTUTUJBAO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |