C11H14F2N2 — CID 167033139
5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine (PubChem CID 167033139) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine.
| Compound Name | 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine |
|---|---|
| PubChem CID | 167033139 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine |
| SMILES | Cc1ccc([C@@H]2CC(F)(F)CCN2)cn1 |
| InChI | InChI=1S/C11H14F2N2/c1-8-2-3-9(7-15-8)10-6-11(12,13)4-5-14-10/h2-3,7,10,14H,4-6H2,1H3/t10-/m0/s1 |
| InChIKey | CHWBIKGFEMYSDQ-JTQLQIEISA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |