About 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine
5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine (PubChem CID 167033139) has the molecular formula C11H14F2N2
and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine.
Molecular Properties
| Compound Name | 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine |
| PubChem CID | 167033139 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine |
| SMILES | Cc1ccc([C@@H]2CC(F)(F)CCN2)cn1 |
| InChI | InChI=1S/C11H14F2N2/c1-8-2-3-9(7-15-8)10-6-11(12,13)4-5-14-10/h2-3,7,10,14H,4-6H2,1H3/t10-/m0/s1 |
| InChIKey | CHWBIKGFEMYSDQ-JTQLQIEISA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine?
The IUPAC name of 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine (CID 167033139) is 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine.
What is the SMILES notation for 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine?
The canonical SMILES for 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine is Cc1ccc([C@@H]2CC(F)(F)CCN2)cn1.
What is the InChIKey of 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine?
The InChIKey is CHWBIKGFEMYSDQ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H14F2N2/c1-8-2-3-9(7-15-8)10-6-11(12,13)4-5-14-10/h2-3,7,10,14H,4-6H2,1H3/t10-/m0/s1.
What are the key properties of 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine?
5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine has a molecular weight of 212.24 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-4,4-difluoropiperidin-2-yl]-2-methylpyridine is sourced from PubChem (CID 167033139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).