C11H14ClF2N — CID 115039890
4,4-difluoro-2-(3-methylphenyl)pyrrolidine;hydrochloride (PubChem CID 115039890) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is 4,4-difluoro-2-(3-methylphenyl)pyrrolidine;hydrochloride.
| Compound Name | 4,4-difluoro-2-(3-methylphenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 115039890 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4,4-difluoro-2-(3-methylphenyl)pyrrolidine;hydrochloride |
| SMILES | Cc1cccc(C2CC(F)(F)CN2)c1.Cl |
| InChI | InChI=1S/C11H13F2N.ClH/c1-8-3-2-4-9(5-8)10-6-11(12,13)7-14-10;/h2-5,10,14H,6-7H2,1H3;1H |
| InChIKey | JRPUEDWJSFLKCU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |