C14H18F2 — CID 138569427
1-[(2R)-5,5-difluoro-2-methylcyclohexyl]-3-methylbenzene (PubChem CID 138569427) has the molecular formula C14H18F2 and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-[(2R)-5,5-difluoro-2-methylcyclohexyl]-3-methylbenzene.
| Compound Name | 1-[(2R)-5,5-difluoro-2-methylcyclohexyl]-3-methylbenzene |
|---|---|
| PubChem CID | 138569427 |
| Molecular Formula | C14H18F2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-[(2R)-5,5-difluoro-2-methylcyclohexyl]-3-methylbenzene |
| SMILES | Cc1cccc(C2CC(F)(F)CC[C@H]2C)c1 |
| InChI | InChI=1S/C14H18F2/c1-10-4-3-5-12(8-10)13-9-14(15,16)7-6-11(13)2/h3-5,8,11,13H,6-7,9H2,1-2H3/t11-,13?/m1/s1 |
| InChIKey | ULNVQRMONUQFJH-JTDNENJMSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |