C13H14F2O2 — CID 155163175
trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid (PubChem CID 155163175) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155163175 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC(F)(F)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14F2O2/c14-13(15)7-6-10(12(16)17)11(8-13)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | OOJQYBADYCKONC-WDEREUQCSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |