About trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid
trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid (PubChem CID 155163175) has the molecular formula C13H14F2O2
and a molecular weight of 240.25 g/mol. Its IUPAC name is trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid |
| PubChem CID | 155163175 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC(F)(F)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14F2O2/c14-13(15)7-6-10(12(16)17)11(8-13)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | OOJQYBADYCKONC-WDEREUQCSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid?
The IUPAC name of trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid (CID 155163175) is trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid.
What is the SMILES notation for trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid?
The canonical SMILES for trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid is O=C(O)[C@H]1CCC(F)(F)C[C@@H]1c1ccccc1.
What is the InChIKey of trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid?
The InChIKey is OOJQYBADYCKONC-WDEREUQCSA-N. The full InChI is InChI=1S/C13H14F2O2/c14-13(15)7-6-10(12(16)17)11(8-13)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,16,17)/t10-,11+/m0/s1.
What are the key properties of trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid?
trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid has a molecular weight of 240.25 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-4,4-difluoro-2-phenylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 155163175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).