C20H19NO3 — CID 166652459
(1R,2R,4R)-4-hydroxy-2-phenyl-4-(2-pyridin-3-ylethynyl)cyclohexane-1-carboxylic acid (PubChem CID 166652459) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (1R,2R,4R)-4-hydroxy-2-phenyl-4-(2-pyridin-3-ylethynyl)cyclohexane-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-4-hydroxy-2-phenyl-4-(2-pyridin-3-ylethynyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166652459 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (1R,2R,4R)-4-hydroxy-2-phenyl-4-(2-pyridin-3-ylethynyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@](O)(C#Cc2cccnc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c22-19(23)17-9-11-20(24,10-8-15-5-4-12-21-14-15)13-18(17)16-6-2-1-3-7-16/h1-7,12,14,17-18,24H,9,11,13H2,(H,22,23)/t17-,18+,20-/m1/s1 |
| InChIKey | CIWNYEHDZJVVGH-WSTZPKSXSA-N |
| XLogP | 2.83 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|