C17H18N2O — CID 110868702
(2-methyl-3-phenylpyrrolidin-1-yl)-pyridin-3-ylmethanone (PubChem CID 110868702) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (2-methyl-3-phenylpyrrolidin-1-yl)-pyridin-3-ylmethanone.
| Compound Name | (2-methyl-3-phenylpyrrolidin-1-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110868702 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2-methyl-3-phenylpyrrolidin-1-yl)-pyridin-3-ylmethanone |
| SMILES | CC1C(c2ccccc2)CCN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C17H18N2O/c1-13-16(14-6-3-2-4-7-14)9-11-19(13)17(20)15-8-5-10-18-12-15/h2-8,10,12-13,16H,9,11H2,1H3 |
| InChIKey | WWNGDQYCEMZRCK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |