C18H18ClNO — CID 95974609
(3-chlorophenyl)-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]methanone (PubChem CID 95974609) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is (3-chlorophenyl)-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95974609 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (3-chlorophenyl)-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]methanone |
| SMILES | C[C@H]1[C@@H](c2ccccc2)CCN1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClNO/c1-13-17(14-6-3-2-4-7-14)10-11-20(13)18(21)15-8-5-9-16(19)12-15/h2-9,12-13,17H,10-11H2,1H3/t13-,17-/m0/s1 |
| InChIKey | QJFWYFZVQFKSMV-GUYCJALGSA-N |
| XLogP | 4.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |