C20H21NO4 — CID 119186874
2-[3-(2-methyl-3-phenylpyrrolidine-1-carbonyl)phenoxy]acetic acid (PubChem CID 119186874) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[3-(2-methyl-3-phenylpyrrolidine-1-carbonyl)phenoxy]acetic acid.
| Compound Name | 2-[3-(2-methyl-3-phenylpyrrolidine-1-carbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 119186874 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[3-(2-methyl-3-phenylpyrrolidine-1-carbonyl)phenoxy]acetic acid |
| SMILES | CC1C(c2ccccc2)CCN1C(=O)c1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C20H21NO4/c1-14-18(15-6-3-2-4-7-15)10-11-21(14)20(24)16-8-5-9-17(12-16)25-13-19(22)23/h2-9,12,14,18H,10-11,13H2,1H3,(H,22,23) |
| InChIKey | SHFOHLHGFXXBJV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |