C14H17NO6S2 — CID 119186354
2-[3-(3-methylsulfonylthiomorpholine-4-carbonyl)phenoxy]acetic acid (PubChem CID 119186354) has the molecular formula C14H17NO6S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[3-(3-methylsulfonylthiomorpholine-4-carbonyl)phenoxy]acetic acid.
| Compound Name | 2-[3-(3-methylsulfonylthiomorpholine-4-carbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 119186354 |
| Molecular Formula | C14H17NO6S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-[3-(3-methylsulfonylthiomorpholine-4-carbonyl)phenoxy]acetic acid |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)c1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C14H17NO6S2/c1-23(19,20)12-9-22-6-5-15(12)14(18)10-3-2-4-11(7-10)21-8-13(16)17/h2-4,7,12H,5-6,8-9H2,1H3,(H,16,17) |
| InChIKey | BEJZXKCXZSGLRG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |