C9H15NO5S2 — CID 66384140
4-(3-methylsulfonylthiomorpholin-4-yl)-4-oxobutanoic acid (PubChem CID 66384140) has the molecular formula C9H15NO5S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(3-methylsulfonylthiomorpholin-4-yl)-4-oxobutanoic acid.
| Compound Name | 4-(3-methylsulfonylthiomorpholin-4-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 66384140 |
| Molecular Formula | C9H15NO5S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-(3-methylsulfonylthiomorpholin-4-yl)-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)CCC(=O)O |
| InChI | InChI=1S/C9H15NO5S2/c1-17(14,15)8-6-16-5-4-10(8)7(11)2-3-9(12)13/h8H,2-6H2,1H3,(H,12,13) |
| InChIKey | ZMBQKARZJNXGLF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |