C8H14N2O3S3 — CID 66384218
3-(3-methylsulfonylthiomorpholin-4-yl)-3-oxopropanethioamide (PubChem CID 66384218) has the molecular formula C8H14N2O3S3 and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-(3-methylsulfonylthiomorpholin-4-yl)-3-oxopropanethioamide.
| Compound Name | 3-(3-methylsulfonylthiomorpholin-4-yl)-3-oxopropanethioamide |
|---|---|
| PubChem CID | 66384218 |
| Molecular Formula | C8H14N2O3S3 |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-(3-methylsulfonylthiomorpholin-4-yl)-3-oxopropanethioamide |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)CC(N)=S |
| InChI | InChI=1S/C8H14N2O3S3/c1-16(12,13)8-5-15-3-2-10(8)7(11)4-6(9)14/h8H,2-5H2,1H3,(H2,9,14) |
| InChIKey | MBIUBOZURFZLMW-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|