C12H22N2O3S2 — CID 81168313
2-[1-(aminomethyl)cyclobutyl]-1-(3-methylsulfonylthiomorpholin-4-yl)ethanone (PubChem CID 81168313) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclobutyl]-1-(3-methylsulfonylthiomorpholin-4-yl)ethanone.
| Compound Name | 2-[1-(aminomethyl)cyclobutyl]-1-(3-methylsulfonylthiomorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 81168313 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[1-(aminomethyl)cyclobutyl]-1-(3-methylsulfonylthiomorpholin-4-yl)ethanone |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)CC1(CN)CCC1 |
| InChI | InChI=1S/C12H22N2O3S2/c1-19(16,17)11-8-18-6-5-14(11)10(15)7-12(9-13)3-2-4-12/h11H,2-9,13H2,1H3 |
| InChIKey | IPCDKDVKVDKIJQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |