C9H15NO6S2 — CID 66384334
2-[2-(3-methylsulfonylthiomorpholin-4-yl)-2-oxoethoxy]acetic acid (PubChem CID 66384334) has the molecular formula C9H15NO6S2 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[2-(3-methylsulfonylthiomorpholin-4-yl)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(3-methylsulfonylthiomorpholin-4-yl)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 66384334 |
| Molecular Formula | C9H15NO6S2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-[2-(3-methylsulfonylthiomorpholin-4-yl)-2-oxoethoxy]acetic acid |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)COCC(=O)O |
| InChI | InChI=1S/C9H15NO6S2/c1-18(14,15)8-6-17-3-2-10(8)7(11)4-16-5-9(12)13/h8H,2-6H2,1H3,(H,12,13) |
| InChIKey | SCYWJCOMTSJWCC-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |