C13H26N2O3S2 — CID 66384023
(3S)-3-(aminomethyl)-5-methyl-1-(3-methylsulfonylthiomorpholin-4-yl)hexan-1-one (PubChem CID 66384023) has the molecular formula C13H26N2O3S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-5-methyl-1-(3-methylsulfonylthiomorpholin-4-yl)hexan-1-one.
| Compound Name | (3S)-3-(aminomethyl)-5-methyl-1-(3-methylsulfonylthiomorpholin-4-yl)hexan-1-one |
|---|---|
| PubChem CID | 66384023 |
| Molecular Formula | C13H26N2O3S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (3S)-3-(aminomethyl)-5-methyl-1-(3-methylsulfonylthiomorpholin-4-yl)hexan-1-one |
| SMILES | CC(C)C[C@H](CN)CC(=O)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O3S2/c1-10(2)6-11(8-14)7-12(16)15-4-5-19-9-13(15)20(3,17)18/h10-11,13H,4-9,14H2,1-3H3/t11-,13?/m0/s1 |
| InChIKey | MJDBWQQKCMKIJH-AMGKYWFPSA-N |
| XLogP | 0.94 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |