C10H20N2O3S2 — CID 66377754
3-amino-1-(3-ethylsulfonylthiomorpholin-4-yl)butan-1-one (PubChem CID 66377754) has the molecular formula C10H20N2O3S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 3-amino-1-(3-ethylsulfonylthiomorpholin-4-yl)butan-1-one.
| Compound Name | 3-amino-1-(3-ethylsulfonylthiomorpholin-4-yl)butan-1-one |
|---|---|
| PubChem CID | 66377754 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-amino-1-(3-ethylsulfonylthiomorpholin-4-yl)butan-1-one |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)CC(C)N |
| InChI | InChI=1S/C10H20N2O3S2/c1-3-17(14,15)10-7-16-5-4-12(10)9(13)6-8(2)11/h8,10H,3-7,11H2,1-2H3 |
| InChIKey | WIRDGEFPXCVYHI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |