C9H16N2O3S — CID 82904428
4-(3-aminobutanoyl)thiomorpholine-3-carboxylic acid (PubChem CID 82904428) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 4-(3-aminobutanoyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(3-aminobutanoyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82904428 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 4-(3-aminobutanoyl)thiomorpholine-3-carboxylic acid |
| SMILES | CC(N)CC(=O)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C9H16N2O3S/c1-6(10)4-8(12)11-2-3-15-5-7(11)9(13)14/h6-7H,2-5,10H2,1H3,(H,13,14) |
| InChIKey | SAKCPGKTRVXHLZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |