C10H18N2O3S — CID 107570416
4-[(2R)-2-aminopentanoyl]thiomorpholine-3-carboxylic acid (PubChem CID 107570416) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-[(2R)-2-aminopentanoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(2R)-2-aminopentanoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 107570416 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-[(2R)-2-aminopentanoyl]thiomorpholine-3-carboxylic acid |
| SMILES | CCC[C@@H](N)C(=O)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C10H18N2O3S/c1-2-3-7(11)9(13)12-4-5-16-6-8(12)10(14)15/h7-8H,2-6,11H2,1H3,(H,14,15)/t7-,8?/m1/s1 |
| InChIKey | KQLBHBITSLWWIC-GVHYBUMESA-N |
| XLogP | 0.14 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |