C8H16N2OS — CID 70304364
(2S)-2-amino-1-(1,3-thiazolidin-3-yl)pentan-1-one (PubChem CID 70304364) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is (2S)-2-amino-1-(1,3-thiazolidin-3-yl)pentan-1-one.
| Compound Name | (2S)-2-amino-1-(1,3-thiazolidin-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 70304364 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2S)-2-amino-1-(1,3-thiazolidin-3-yl)pentan-1-one |
| SMILES | CCC[C@H](N)C(=O)N1CCSC1 |
| InChI | InChI=1S/C8H16N2OS/c1-2-3-7(9)8(11)10-4-5-12-6-10/h7H,2-6,9H2,1H3/t7-/m0/s1 |
| InChIKey | ICOYNNGOQBPNFY-ZETCQYMHSA-N |
| XLogP | 0.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |