C9H18N2O3 — CID 107570937
(2R)-2-amino-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one (PubChem CID 107570937) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2R)-2-amino-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one.
| Compound Name | (2R)-2-amino-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 107570937 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2R)-2-amino-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one |
| SMILES | CCC[C@@H](N)C(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C9H18N2O3/c1-2-3-6(10)9(14)11-4-7(12)8(13)5-11/h6-8,12-13H,2-5,10H2,1H3/t6-,7?,8?/m1/s1 |
| InChIKey | CVBHIGDGYQHQPY-JECWYVHBSA-N |
| XLogP | -1.32 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |