C8H16N2O3 — CID 107220584
2-amino-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]butan-1-one (PubChem CID 107220584) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-amino-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]butan-1-one.
| Compound Name | 2-amino-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 107220584 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-amino-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]butan-1-one |
| SMILES | CCC(N)C(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H16N2O3/c1-2-5(9)8(13)10-3-6(11)7(12)4-10/h5-7,11-12H,2-4,9H2,1H3/t5?,6-,7+ |
| InChIKey | BOCPJUCBIPGUJT-DGUCWDHESA-N |
| XLogP | -1.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |