C12H24N2OS — CID 107571032
(2S)-2-amino-1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentan-1-one (PubChem CID 107571032) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is (2S)-2-amino-1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentan-1-one.
| Compound Name | (2S)-2-amino-1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 107571032 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2S)-2-amino-1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentan-1-one |
| SMILES | CCC[C@H](N)C(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C12H24N2OS/c1-4-5-10(13)11(15)14-7-6-12(2,3)16-9-8-14/h10H,4-9,13H2,1-3H3/t10-/m0/s1 |
| InChIKey | QBTZSHRVDSRJIM-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |