C9H16ClNOS — CID 107453818
2-chloro-1-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone (PubChem CID 107453818) has the molecular formula C9H16ClNOS and a molecular weight of 221.75 g/mol. Its IUPAC name is 2-chloro-1-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone.
| Compound Name | 2-chloro-1-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 107453818 |
| Molecular Formula | C9H16ClNOS |
| Molecular Weight | 221.75 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-chloro-1-(7,7-dimethyl-1,4-thiazepan-4-yl)ethanone |
| SMILES | CC1(C)CCN(C(=O)CCl)CCS1 |
| InChI | InChI=1S/C9H16ClNOS/c1-9(2)3-4-11(5-6-13-9)8(12)7-10/h3-7H2,1-2H3 |
| InChIKey | TUVPMVGTIKRGMH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|