C12H18Cl3N3O3 — CID 67742151
1-[4,7-bis(2-chloroacetyl)-1,4,7-triazonan-1-yl]-2-chloroethanone (PubChem CID 67742151) has the molecular formula C12H18Cl3N3O3 and a molecular weight of 358.65 g/mol. Its IUPAC name is 1-[4,7-bis(2-chloroacetyl)-1,4,7-triazonan-1-yl]-2-chloroethanone.
| Compound Name | 1-[4,7-bis(2-chloroacetyl)-1,4,7-triazonan-1-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 67742151 |
| Molecular Formula | C12H18Cl3N3O3 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-[4,7-bis(2-chloroacetyl)-1,4,7-triazonan-1-yl]-2-chloroethanone |
| SMILES | O=C(CCl)N1CCN(C(=O)CCl)CCN(C(=O)CCl)CC1 |
| InChI | InChI=1S/C12H18Cl3N3O3/c13-7-10(19)16-1-2-17(11(20)8-14)5-6-18(4-3-16)12(21)9-15/h1-9H2 |
| InChIKey | VITRFBWOHICMMS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|