C10H17ClN2O3 — CID 146102184
2-chloro-1-[4-[(3R,4S)-4-hydroxyoxolan-3-yl]piperazin-1-yl]ethanone (PubChem CID 146102184) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-chloro-1-[4-[(3R,4S)-4-hydroxyoxolan-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-[(3R,4S)-4-hydroxyoxolan-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 146102184 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-chloro-1-[4-[(3R,4S)-4-hydroxyoxolan-3-yl]piperazin-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCN([C@@H]2COC[C@H]2O)CC1 |
| InChI | InChI=1S/C10H17ClN2O3/c11-5-10(15)13-3-1-12(2-4-13)8-6-16-7-9(8)14/h8-9,14H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | MRCTUCOUBOUGQC-RKDXNWHRSA-N |
| XLogP | -0.87 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|