About 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol
4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol (PubChem CID 130503022) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol.
Molecular Properties
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol |
| PubChem CID | 130503022 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol |
| SMILES | O=S1(=O)CCN(C2COCC2O)CC1 |
| InChI | InChI=1S/C8H15NO4S/c10-8-6-13-5-7(8)9-1-3-14(11,12)4-2-9/h7-8,10H,1-6H2 |
| InChIKey | QJXMSYBGCQETRC-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol?
The IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol (CID 130503022) is 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol.
What is the SMILES notation for 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol?
The canonical SMILES for 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol is O=S1(=O)CCN(C2COCC2O)CC1.
What is the InChIKey of 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol?
The InChIKey is QJXMSYBGCQETRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c10-8-6-13-5-7(8)9-1-3-14(11,12)4-2-9/h7-8,10H,1-6H2.
What are the key properties of 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol?
4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol has a molecular weight of 221.28 g/mol, XLogP of -1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,4-thiazinan-4-yl)oxolan-3-ol is sourced from PubChem (CID 130503022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).