C8H15NO4S — CID 1380500
(3R,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-ol (PubChem CID 1380500) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is (3R,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 1380500 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (3R,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](N2CCOCC2)[C@@H](O)C1 |
| InChI | InChI=1S/C8H15NO4S/c10-8-6-14(11,12)5-7(8)9-1-3-13-4-2-9/h7-8,10H,1-6H2/t7-,8+/m1/s1 |
| InChIKey | HXFFTFHXFUEYPB-SFYZADRCSA-N |
| XLogP | -1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |