C9H15ClN2O — CID 71646509
2-chloro-1-(1,7-diazaspiro[3.5]nonan-7-yl)ethanone (PubChem CID 71646509) has the molecular formula C9H15ClN2O and a molecular weight of 202.68 g/mol. Its IUPAC name is 2-chloro-1-(1,7-diazaspiro[3.5]nonan-7-yl)ethanone.
| Compound Name | 2-chloro-1-(1,7-diazaspiro[3.5]nonan-7-yl)ethanone |
|---|---|
| PubChem CID | 71646509 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-chloro-1-(1,7-diazaspiro[3.5]nonan-7-yl)ethanone |
| SMILES | O=C(CCl)N1CCC2(CCN2)CC1 |
| InChI | InChI=1S/C9H15ClN2O/c10-7-8(13)12-5-2-9(3-6-12)1-4-11-9/h11H,1-7H2 |
| InChIKey | DRECBGLHLSGOEN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|