C8H15N3O — CID 71649143
2-amino-1-(1,7-diazaspiro[3.4]octan-7-yl)ethanone (PubChem CID 71649143) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-amino-1-(1,7-diazaspiro[3.4]octan-7-yl)ethanone.
| Compound Name | 2-amino-1-(1,7-diazaspiro[3.4]octan-7-yl)ethanone |
|---|---|
| PubChem CID | 71649143 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-amino-1-(1,7-diazaspiro[3.4]octan-7-yl)ethanone |
| SMILES | NCC(=O)N1CCC2(CCN2)C1 |
| InChI | InChI=1S/C8H15N3O/c9-5-7(12)11-4-2-8(6-11)1-3-10-8/h10H,1-6,9H2 |
| InChIKey | SLUONWZFSMZEFF-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |