C11H24N2O — CID 142306561
2-amino-1-(4,4-dimethylpiperidin-1-yl)ethanone;ethane (PubChem CID 142306561) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-amino-1-(4,4-dimethylpiperidin-1-yl)ethanone;ethane.
| Compound Name | 2-amino-1-(4,4-dimethylpiperidin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 142306561 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-amino-1-(4,4-dimethylpiperidin-1-yl)ethanone;ethane |
| SMILES | CC.CC1(C)CCN(C(=O)CN)CC1 |
| InChI | InChI=1S/C9H18N2O.C2H6/c1-9(2)3-5-11(6-4-9)8(12)7-10;1-2/h3-7,10H2,1-2H3;1-2H3 |
| InChIKey | IMWGTMFKBASLTE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |