C6H8F4N2O — CID 130681510
2-amino-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone (PubChem CID 130681510) has the molecular formula C6H8F4N2O and a molecular weight of 200.13 g/mol. Its IUPAC name is 2-amino-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone.
| Compound Name | 2-amino-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 130681510 |
| Molecular Formula | C6H8F4N2O |
| Molecular Weight | 200.13 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-amino-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)ethanone |
| SMILES | NCC(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C6H8F4N2O/c7-5(8)2-12(4(13)1-11)3-6(5,9)10/h1-3,11H2 |
| InChIKey | LGCKGWGBKHRJNL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.13 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|