C10H20F2N2O — CID 142306583
2-amino-1-(4,4-difluoropiperidin-1-yl)ethanone;propane (PubChem CID 142306583) has the molecular formula C10H20F2N2O and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-amino-1-(4,4-difluoropiperidin-1-yl)ethanone;propane.
| Compound Name | 2-amino-1-(4,4-difluoropiperidin-1-yl)ethanone;propane |
|---|---|
| PubChem CID | 142306583 |
| Molecular Formula | C10H20F2N2O |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-amino-1-(4,4-difluoropiperidin-1-yl)ethanone;propane |
| SMILES | CCC.NCC(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H12F2N2O.C3H8/c8-7(9)1-3-11(4-2-7)6(12)5-10;1-3-2/h1-5,10H2;3H2,1-2H3 |
| InChIKey | FKUQZUMWVFOJNX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |