C14H27F2NO2 — CID 164604907
1-(4,4-difluoropiperidin-1-yl)butan-1-one;3-methylbutan-2-ol (PubChem CID 164604907) has the molecular formula C14H27F2NO2 and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)butan-1-one;3-methylbutan-2-ol.
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)butan-1-one;3-methylbutan-2-ol |
|---|---|
| PubChem CID | 164604907 |
| Molecular Formula | C14H27F2NO2 |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)butan-1-one;3-methylbutan-2-ol |
| SMILES | CC(C)C(C)O.CCCC(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H15F2NO.C5H12O/c1-2-3-8(13)12-6-4-9(10,11)5-7-12;1-4(2)5(3)6/h2-7H2,1H3;4-6H,1-3H3 |
| InChIKey | FDCBCDAFUWYVSW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |