C8H15NOS2 — CID 131201188
1-(1,2,5-dithiazepan-5-yl)butan-1-one (PubChem CID 131201188) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is 1-(1,2,5-dithiazepan-5-yl)butan-1-one.
| Compound Name | 1-(1,2,5-dithiazepan-5-yl)butan-1-one |
|---|---|
| PubChem CID | 131201188 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-(1,2,5-dithiazepan-5-yl)butan-1-one |
| SMILES | CCCC(=O)N1CCSSCC1 |
| InChI | InChI=1S/C8H15NOS2/c1-2-3-8(10)9-4-6-11-12-7-5-9/h2-7H2,1H3 |
| InChIKey | OJGUQONNYBMOIB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|