C9H15NOS2 — CID 130723803
2-cyclopropyl-1-(1,2,5-dithiazepan-5-yl)ethanone (PubChem CID 130723803) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-cyclopropyl-1-(1,2,5-dithiazepan-5-yl)ethanone.
| Compound Name | 2-cyclopropyl-1-(1,2,5-dithiazepan-5-yl)ethanone |
|---|---|
| PubChem CID | 130723803 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-cyclopropyl-1-(1,2,5-dithiazepan-5-yl)ethanone |
| SMILES | O=C(CC1CC1)N1CCSSCC1 |
| InChI | InChI=1S/C9H15NOS2/c11-9(7-8-1-2-8)10-3-5-12-13-6-4-10/h8H,1-7H2 |
| InChIKey | ZPAMFCANLOUHSM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|