C12H22N2O — CID 91255593
2-cyclopropyl-1-(4-ethyl-1,4-diazepan-1-yl)ethanone (PubChem CID 91255593) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-cyclopropyl-1-(4-ethyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-cyclopropyl-1-(4-ethyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 91255593 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-cyclopropyl-1-(4-ethyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CCN1CCCN(C(=O)CC2CC2)CC1 |
| InChI | InChI=1S/C12H22N2O/c1-2-13-6-3-7-14(9-8-13)12(15)10-11-4-5-11/h11H,2-10H2,1H3 |
| InChIKey | KPGOPJBPBCBPRZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |