C17H32N4O3S — CID 50950882
2-(1-ethylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 50950882) has the molecular formula C17H32N4O3S and a molecular weight of 372.54 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1-ethylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 50950882 |
| Molecular Formula | C17H32N4O3S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-(1-ethylpiperidin-4-yl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCC(CC(=O)N2CCN(S(=O)(=O)N3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C17H32N4O3S/c1-2-18-9-5-16(6-10-18)15-17(22)19-11-13-21(14-12-19)25(23,24)20-7-3-4-8-20/h16H,2-15H2,1H3 |
| InChIKey | UMTDFTISTXDWPN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |