C19H33N3O4S — CID 55567324
2-cyclopentyl-1-[4-(1-ethylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]ethanone (PubChem CID 55567324) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-cyclopentyl-1-[4-(1-ethylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[4-(1-ethylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55567324 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-cyclopentyl-1-[4-(1-ethylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N2CCN(C(=O)CC3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C19H33N3O4S/c1-2-27(25,26)22-9-7-17(8-10-22)19(24)21-13-11-20(12-14-21)18(23)15-16-5-3-4-6-16/h16-17H,2-15H2,1H3 |
| InChIKey | MHCQGMBENUKQSR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |