C22H37N3O2 — CID 120988358
1-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]-2-cyclohexylethanone (PubChem CID 120988358) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]-2-cyclohexylethanone.
| Compound Name | 1-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 120988358 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 1-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]-2-cyclohexylethanone |
| SMILES | NC1C2CCCC1CC(C(=O)N1CCN(C(=O)CC3CCCCC3)CC1)C2 |
| InChI | InChI=1S/C22H37N3O2/c23-21-17-7-4-8-18(21)15-19(14-17)22(27)25-11-9-24(10-12-25)20(26)13-16-5-2-1-3-6-16/h16-19,21H,1-15,23H2 |
| InChIKey | NNULXEKFJPDZAJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |