C17H31ClN2O — CID 120983573
(9-amino-3-bicyclo[3.3.1]nonanyl)-(azocan-1-yl)methanone;hydrochloride (PubChem CID 120983573) has the molecular formula C17H31ClN2O and a molecular weight of 314.90 g/mol. Its IUPAC name is (9-amino-3-bicyclo[3.3.1]nonanyl)-(azocan-1-yl)methanone;hydrochloride.
| Compound Name | (9-amino-3-bicyclo[3.3.1]nonanyl)-(azocan-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120983573 |
| Molecular Formula | C17H31ClN2O |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (9-amino-3-bicyclo[3.3.1]nonanyl)-(azocan-1-yl)methanone;hydrochloride |
| SMILES | Cl.NC1C2CCCC1CC(C(=O)N1CCCCCCC1)C2 |
| InChI | InChI=1S/C17H30N2O.ClH/c18-16-13-7-6-8-14(16)12-15(11-13)17(20)19-9-4-2-1-3-5-10-19;/h13-16H,1-12,18H2;1H |
| InChIKey | QNSUNNZFVHSCMD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |