C14H25ClN2O2 — CID 120983451
(9-amino-3-bicyclo[3.3.1]nonanyl)-morpholin-4-ylmethanone;hydrochloride (PubChem CID 120983451) has the molecular formula C14H25ClN2O2 and a molecular weight of 288.82 g/mol. Its IUPAC name is (9-amino-3-bicyclo[3.3.1]nonanyl)-morpholin-4-ylmethanone;hydrochloride.
| Compound Name | (9-amino-3-bicyclo[3.3.1]nonanyl)-morpholin-4-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120983451 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (9-amino-3-bicyclo[3.3.1]nonanyl)-morpholin-4-ylmethanone;hydrochloride |
| SMILES | Cl.NC1C2CCCC1CC(C(=O)N1CCOCC1)C2 |
| InChI | InChI=1S/C14H24N2O2.ClH/c15-13-10-2-1-3-11(13)9-12(8-10)14(17)16-4-6-18-7-5-16;/h10-13H,1-9,15H2;1H |
| InChIKey | PFCABDJOAJMKLF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |