C15H29N3O3S — CID 113003728
(4-ethylpiperazin-1-yl)-(1-propylsulfonylpiperidin-4-yl)methanone (PubChem CID 113003728) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-(1-propylsulfonylpiperidin-4-yl)methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-(1-propylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 113003728 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-(1-propylsulfonylpiperidin-4-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCC(C(=O)N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C15H29N3O3S/c1-3-13-22(20,21)18-7-5-14(6-8-18)15(19)17-11-9-16(4-2)10-12-17/h14H,3-13H2,1-2H3 |
| InChIKey | OCBGUEADIQCMGR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |