C19H38N4O3S — CID 60559721
1-butylsulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 60559721) has the molecular formula C19H38N4O3S and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-butylsulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60559721 |
| Molecular Formula | C19H38N4O3S |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 1-butylsulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NCCCN2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C19H38N4O3S/c1-3-5-17-27(25,26)23-11-7-18(8-12-23)19(24)20-9-6-10-22-15-13-21(4-2)14-16-22/h18H,3-17H2,1-2H3,(H,20,24) |
| InChIKey | DZZAYTJAWKNECH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|