C17H33N3O3S — CID 119556402
1-butylsulfonyl-N-(2-piperidin-3-ylethyl)piperidine-4-carboxamide (PubChem CID 119556402) has the molecular formula C17H33N3O3S and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-butylsulfonyl-N-(2-piperidin-3-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-(2-piperidin-3-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119556402 |
| Molecular Formula | C17H33N3O3S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-butylsulfonyl-N-(2-piperidin-3-ylethyl)piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NCCC2CCCNC2)CC1 |
| InChI | InChI=1S/C17H33N3O3S/c1-2-3-13-24(22,23)20-11-7-16(8-12-20)17(21)19-10-6-15-5-4-9-18-14-15/h15-16,18H,2-14H2,1H3,(H,19,21) |
| InChIKey | WVGWHIAFSMNJAE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |