C15H30ClN3O3S — CID 119554979
N-(2-piperidin-3-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride (PubChem CID 119554979) has the molecular formula C15H30ClN3O3S and a molecular weight of 367.94 g/mol. Its IUPAC name is N-(2-piperidin-3-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride.
| Compound Name | N-(2-piperidin-3-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119554979 |
| Molecular Formula | C15H30ClN3O3S |
| Molecular Weight | 367.94 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(2-piperidin-3-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride |
| SMILES | Cl.O=C(CCCS(=O)(=O)N1CCCC1)NCCC1CCCNC1 |
| InChI | InChI=1S/C15H29N3O3S.ClH/c19-15(17-9-7-14-5-3-8-16-13-14)6-4-12-22(20,21)18-10-1-2-11-18;/h14,16H,1-13H2,(H,17,19);1H |
| InChIKey | JHBDBZRPXHGGHF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.94 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |