C16H31N3O4S — CID 113003547
1-butylsulfonyl-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide (PubChem CID 113003547) has the molecular formula C16H31N3O4S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-butylsulfonyl-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113003547 |
| Molecular Formula | C16H31N3O4S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 1-butylsulfonyl-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C16H31N3O4S/c1-2-3-14-24(21,22)19-7-4-15(5-8-19)16(20)17-6-9-18-10-12-23-13-11-18/h15H,2-14H2,1H3,(H,17,20) |
| InChIKey | XZTCFWFUSCCLRP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |