C16H30N4O4S — CID 3448160
N-(2-morpholin-4-ylethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3448160) has the molecular formula C16H30N4O4S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3448160 |
| Molecular Formula | C16H30N4O4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C16H30N4O4S/c21-16(17-5-10-18-11-13-24-14-12-18)15-3-8-20(9-4-15)25(22,23)19-6-1-2-7-19/h15H,1-14H2,(H,17,21) |
| InChIKey | RTOIILDOCGELGN-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |