C20H38N4O3S — CID 4135815
N-[2-(azepan-1-yl)ethyl]-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-4-carboxamide (PubChem CID 4135815) has the molecular formula C20H38N4O3S and a molecular weight of 414.62 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 4135815 |
| Molecular Formula | C20H38N4O3S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)N2CCC(C(=O)NCCN3CCCCCC3)CC2)CC1 |
| InChI | InChI=1S/C20H38N4O3S/c1-18-6-13-23(14-7-18)28(26,27)24-15-8-19(9-16-24)20(25)21-10-17-22-11-4-2-3-5-12-22/h18-19H,2-17H2,1H3,(H,21,25) |
| InChIKey | YHCBWYFSENVCNE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |