C14H25N3O4 — CID 110754087
methyl 4-(2-morpholin-4-ylethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 110754087) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 4-(2-morpholin-4-ylethylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | methyl 4-(2-morpholin-4-ylethylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110754087 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | methyl 4-(2-morpholin-4-ylethylcarbamoyl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C14H25N3O4/c1-20-14(19)17-5-2-12(3-6-17)13(18)15-4-7-16-8-10-21-11-9-16/h12H,2-11H2,1H3,(H,15,18) |
| InChIKey | PKNYENFIRKWIQE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |